| Name | 4-oxobutanoic acid |
| Synonyms | 4-oxobutyric acid 4-oxobutanoic acid SUCCINALDEHYDIC ACID butanoic acid, 4-oxo- Β-FORMYLPROPIONIC ACID |
| CAS | 692-29-5 |
| InChI | InChI=1/C4H6O3/c5-3-1-2-4(6)7/h3H,1-2H2,(H,6,7) |
| Molecular Formula | C4H6O3 |
| Molar Mass | 102.09 |
| Density | 1.18g/cm3 |
| Melting Point | 202-203 °C(Solv: methanol (67-56-1)) |
| Boling Point | 248.6°C at 760 mmHg |
| Flash Point | 118.4°C |
| Vapor Presure | 0.00768mmHg at 25°C |
| Appearance | Form Solid, color White to Off-White |
| pKa | 4.69±0.17(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.429 |
| Use | Uses Succinhemialdehyde, also called 3-aldol propionic acid, is an organic intermediate that can be used to prepare indole acetic acid derivatives. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/38 - Irritating to eyes and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| Solubility | DMSO (Slightly), Methanol (Slightly) |